raaeraae22
raaeraae22
04-02-2017
Chemistry
contestada
When is di- used in the name of a hydrocarbon?
Respuesta :
DoctorCass
DoctorCass
04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link
VER TODAS LAS RESPUESTAS ( 79+ )
Otras preguntas
how many times largeris the value 250,000 than 250
A rectangular prism with a volume of 555 cubic units is filled with cubes with side lengths of \dfrac13 3 1 start fraction, 1, divided by, 3, end fraction
Standing in line at a small-town grocery store gives people a chance to socialize. Is this a positive externality associated with the act of shopping? Why or wh
Write the equation of the line that passes through the point (3, -5) and is perpendicular to the line x = 4.
A worker lifts a load of 200 N with the help of a lever by applying an effort of 50 N. The load iskept at a distance of 20 cm and the effort is applied at a dis
The sum of 2 positive numbers is 151. The lesser number is 19 more than the square root of the greater number. What is the greater number?
A) A cross-section of a solid circular rod is subject to a torque of T = 3.5 kNâ‹…m. If the diameter of the rod is D = 5 cm, what is the maximum shear stress? i
After you turn on the tea machine, what is the minimum amount of time you should wait before brewing tea?
primary structure of monocot and dicot shoot and more information and explanation about it
A movie theater sells student tickets for $6 and adults for $8. The theater sold 140 tickets, generating $990. How many student tickets were sold
